CAS 47543-65-7
:1-[2-[3-(2,2-Diphenylethyl)-1,2,4-oxadiazol-5-yl]ethyl]piperidine
Description:
1-[2-[3-(2,2-Diphenylethyl)-1,2,4-oxadiazol-5-yl]ethyl]piperidine, with the CAS number 47543-65-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an oxadiazole moiety. The presence of the diphenylethyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to the combination of the piperidine and oxadiazole functionalities, which are often associated with various biological activities, including analgesic and anti-inflammatory effects. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making this compound a subject of interest in medicinal chemistry. Additionally, the structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Overall, the unique combination of functional groups in this compound may lead to diverse applications in pharmaceuticals and materials science.
Formula:C23H27N3O
InChI:InChI=1S/C23H27N3O/c1-4-10-19(11-5-1)21(20-12-6-2-7-13-20)18-22-24-23(27-25-22)14-17-26-15-8-3-9-16-26/h1-2,4-7,10-13,21H,3,8-9,14-18H2
InChI key:InChIKey=PXZDWASDNFWKSD-UHFFFAOYSA-N
SMILES:C(CC=1N=C(CCN2CCCCC2)ON1)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 1-(2-(3-(2,2-Diphenylethyl)-1,2,4-oxadiazol-5-yl)ethyl)piperidine
- Piperidine, 1-[2-[3-(2,2-diphenylethyl)-1,2,4-oxadiazol-5-yl]ethyl]-
- Prenoxdiazine [INN]
- Unii-S491Hh391H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

