CymitQuimica logo

CAS 475488-23-4

:

ADW742

Description:
ADW742, with the CAS number 475488-23-4, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is characterized as a selective inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth and division. The compound's structure typically features specific functional groups that enhance its binding affinity to target proteins, making it a candidate for drug development. ADW742 has been studied for its efficacy in inhibiting tumor growth in various cancer models, showcasing its potential as an anticancer agent. Additionally, its pharmacokinetic properties, such as solubility and stability, are essential for determining its suitability for clinical use. As research continues, understanding the full spectrum of its biological activity and safety profile will be critical for advancing its application in therapeutic settings.
Formula:C28H31N5O
InChI:InChI=1S/C28H31N5O/c29-27-26-25(22-9-6-10-24(15-22)34-18-20-7-2-1-3-8-20)17-33(28(26)31-19-30-27)23-13-21(14-23)16-32-11-4-5-12-32/h1-3,6-10,15,17,19,21,23H,4-5,11-14,16,18H2,(H2,29,30,31)
InChI key:LSFLAQVDISHMNB-UHFFFAOYSA-N
SMILES:C1CCN(C1)CC2CC(C2)N3C=C(C4=C(N=CN=C43)N)C5=CC(=CC=C5)OCC6=CC=CC=C6
Found 4 products.