CAS 475489-16-8: AEW-541
Description:AEW-541, with the CAS number 475489-16-8, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is characterized by its specific molecular structure, which includes various functional groups that contribute to its biological activity. AEW-541 has been studied for its role as a selective inhibitor of certain protein kinases, which are crucial in regulating various cellular processes, including growth and metabolism. This inhibition can lead to significant effects on cancer cell proliferation and survival, making AEW-541 a candidate for cancer treatment research. Additionally, the compound's solubility, stability, and pharmacokinetic properties are essential for its efficacy and safety in potential therapeutic applications. As with many experimental compounds, ongoing research is necessary to fully understand its mechanisms of action, optimal dosing, and potential side effects. Overall, AEW-541 represents a promising area of study in the development of targeted cancer therapies.
Formula:C27H29N5O
InChI:InChI=1/C27H29N5O/c28-26-25-24(21-8-4-9-23(14-21)33-17-19-6-2-1-3-7-19)16-32(27(25)30-18-29-26)22-12-20(13-22)15-31-10-5-11-31/h1-4,6-9,14,16,18,20,22H,5,10-13,15,17H2,(H2,28,29,30)/t20-,22+
InChI key:InChIKey=AECDBHGVIIRMOI-GRGXKFILNA-N
SMILES:N=1C=NC2=C(C1N)C(=CN2C3CC(CN4CCC4)C3)C=5C=CC=C(OCC=6C=CC=CC6)C5
![[7-[Cis-3-[(Azacyclobutane-1-Yl)Methyl]Cyclobutyl]-5-(3-Benzyloxyphenyl)-7H-Pyrrolo[2,3-D] Pyrimid…](https://static.cymitquimica.com/products/54/thumb/OR1023746.jpg)
