CAS 475561-81-0
:rel-1-(1,1-Dimethylethyl) 2-methyl (2R,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate
Description:
Rel-1-(1,1-Dimethylethyl) 2-methyl (2R,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate, with the CAS number 475561-81-0, is a chemical compound characterized by its pyrrolidine structure, which includes two carboxylate groups and a fluorine substituent. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) and the fluorine atom can influence the compound's lipophilicity, stability, and interaction with biological targets. Its stereochemistry, indicated by the (2R,4R) configuration, suggests specific spatial arrangements that may be crucial for its activity and efficacy in biological systems. As a diester, it may also exhibit properties such as solubility in organic solvents and potential reactivity with nucleophiles. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug design.
Formula:C11H18FNO4
InChI:InChI=1/C11H18FNO4/c1-11(2,3)17-10(15)13-6-7(12)5-8(13)9(14)16-4/h7-8H,5-6H2,1-4H3/t7-,8-/s2
InChI key:InChIKey=METPQQHVRNLTRX-YZYOREDDNA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@H](C(OC)=O)C[C@H](F)C1
Synonyms:- 1,2-Pyrrolidinedicarboxylic acid, 4-fluoro-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R,4R)-rel-
- rel-1-(1,1-Dimethylethyl) 2-methyl (2R,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rel-1-(1,1-Dimethylethyl) 2-methyl (2R,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate
CAS:Formula:C11H18FNO4Molecular weight:247.2633
