CAS 4756-52-9
:Tributylstannyl 4-methylbenzenesulfonate
Description:
Tributylstannyl 4-methylbenzenesulfonate, with the CAS number 4756-52-9, is an organotin compound characterized by the presence of a tributylstannyl group attached to a 4-methylbenzenesulfonate moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity and utility in organic synthesis, particularly in coupling reactions and as a reagent in various chemical transformations. The tributylstannyl group contributes to its properties as a nucleophile, while the sulfonate group enhances its solubility in organic solvents. It is important to note that organotin compounds can exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Additionally, the compound may participate in various reactions, including nucleophilic substitutions and cross-coupling processes, making it valuable in the synthesis of complex organic molecules. As with many organotin compounds, regulatory considerations regarding its use and potential environmental impact should be taken into account.
Formula:C19H34O3SSn
InChI:InChI=1S/C7H8O3S.3C4H9.Sn/c1-6-2-4-7(5-3-6)11(8,9)10;3*1-3-4-2;/h2-5H,1H3,(H,8,9,10);3*1,3-4H2,2H3;/q;;;;+1/p-1
InChI key:InChIKey=YIJDXAZCJBCTKI-UHFFFAOYSA-M
SMILES:[Sn](OS(=O)(=O)C1=CC=C(C)C=C1)(CCCC)(CCCC)CCCC
Synonyms:- Tin, tributyl[(p-tolylsulfonyl)oxy]-
- Tributylstannyl 4-methylbenzenesulfonate
- Stannane, tributyl[[(4-methylphenyl)sulfonyl]oxy]-
- Benzenesulfonic acid, 4-methyl-, tributylstannyl ester
- Tributyltin p-toluenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
