CAS 476-32-4
:(+)-Chelidonine
Description:
(+)-Chelidonine is a naturally occurring alkaloid derived from the plant Chelidonium majus, commonly known as greater celandine. It belongs to the benzophenanthridine class of alkaloids and is characterized by its complex polycyclic structure, which includes a fused ring system. This compound exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. (+)-Chelidonine is typically found in the form of a yellowish crystalline solid and is soluble in organic solvents such as ethanol and chloroform, but less soluble in water. Its stereochemistry is significant, as the (+) designation indicates its specific optical activity, which can influence its biological interactions. The compound's mechanism of action and therapeutic potential are subjects of ongoing investigation, highlighting its relevance in natural product chemistry and medicinal applications. As with many alkaloids, caution is advised regarding its use, as it may exhibit toxicity at certain concentrations.
Formula:C20H19NO5
InChI:InChI=1S/C20H19NO5/c1-21-7-13-11(2-3-15-20(13)26-9-23-15)18-14(22)4-10-5-16-17(25-8-24-16)6-12(10)19(18)21/h2-3,5-6,14,18-19,22H,4,7-9H2,1H3/t14-,18-,19+/m0/s1
InChI key:InChIKey=GHKISGDRQRSCII-ZOCIIQOWSA-N
SMILES:CN1[C@]2([C@@](C=3C(C1)=C4C(=CC3)OCO4)([C@@H](O)CC=5C2=CC6=C(C5)OCO6)[H])[H]
Synonyms:- (5bR,6S,12bS)-5b,6,7,12b,13,14-Hexahydro-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-6-ol
- Chelidonin
- Diphylline
- Stylophorine
- [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-6-ol, 5b,6,7,12b,13,14-hexahydro-13-methyl-, (5bR,6S,12bS)-
- [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-6-ol, 5b,6,7,12b,13,14-hexahydro-13-methyl-, [5bR-(5bα,6β,12bα)]-
- [5bR-(5bα,6β,12bα)]-5b,6,7,12b,13,14-Hexahydro-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-6-ol
- Chelidonine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(+)-Chelidonine
CAS:(+)-Chelidonine analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C20H19NO5Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:353.38(5bR,6S,12bS)-5b,6,7,12b,13,14-Hexahydro-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-6-ol
CAS:Formula:C20H19NO5Purity:98%Color and Shape:SolidMolecular weight:353.3686Chelidonine
CAS:Formula:C20H19NO5Purity:≥ 97.0%Color and Shape:White to light brown powder or crystalsMolecular weight:353.37Chelidonine
CAS:Chelidonine from Chelidonium majus triggers HeLa cell apoptosis, may reverse MDR, boost chemotherapeutics against leukemia, and inhibit cancer cell metastasis.Formula:C20H19NO5Purity:98% - 99.61%Color and Shape:SolidMolecular weight:353.37Chelidonine
CAS:Natural alkaloidFormula:C20H19NO5Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:353.38Stylophorin
CAS:Stylophorin is a biochemical agent, which is derived from marine organisms, specifically from the symbiotic bacteria associated with certain marine invertebrates. This compound exhibits its effects through the disruption of bacterial cell walls or inhibition of vital microbial enzymatic pathways, leading to antimicrobial activity.Formula:C20H19NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:353.37 g/mol







