CAS 476-34-6
:isoindigotin
Description:
Isoindigotin, with the CAS number 476-34-6, is a synthetic organic compound that belongs to the class of indigo derivatives. It is characterized by its deep blue color, which is attributed to its conjugated double bond system that allows for effective light absorption in the visible spectrum. Isoindigotin is typically used as a dye and pigment in various applications, including textiles, inks, and coatings, due to its stability and vibrant hue. The compound exhibits good solubility in organic solvents but is generally insoluble in water, which is a common trait among many indigo derivatives. Its chemical structure features a bicyclic framework, which contributes to its unique properties and reactivity. Isoindigotin can undergo various chemical transformations, making it a versatile compound in organic synthesis. Additionally, it is important to handle isoindigotin with care, as with many synthetic dyes, due to potential environmental and health concerns associated with certain dye compounds.
Formula:C16H10N2O2
InChI:InChI=1/C16H10N2O2/c19-15-13(9-5-1-3-7-11(9)17-15)14-10-6-2-4-8-12(10)18-16(14)20/h1-8H,(H,17,19)(H,18,20)/b14-13+
Synonyms:- 2H-Indol-2-one, 3-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)-1,3-dihydro-
- (3E)-3,3'-biindole-2,2'(1H,1'H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Isoindigotin
CAS:Isoindigotin is used in the therapy of Y.Formula:C16H10N2O2Purity:98.14% - ≥95%Color and Shape:Red SolidMolecular weight:262.26Isoindigo
CAS:Controlled ProductApplications Isoindigo has proven successful as an electron-accepting building block for the preparation of electroactive materials for organic electronics. Meisoindigo, as a functionalized Isoindigo, has been used as an indirubin substitute for the treatment of chronic myeloid leukemia (CML).
References Stalder, R., et al.: Chem. Mater., 26, 664 (2014); Wee, X., et al.: ChemMedChem, 7, 777 (2012); Wee, X., et al.: Bioorg. Med. Chem., 17, 7262 (2009)Formula:C16H12N2OColor and Shape:NeatMolecular weight:248.28





