CymitQuimica logo

CAS 476472-28-3

:

2-(6-Bromo-4-quinolinyl)-1-(6-methyl-2-pyridinyl)ethanone

Description:
2-(6-Bromo-4-quinolinyl)-1-(6-methyl-2-pyridinyl)ethanone is a chemical compound characterized by its complex structure, which includes a quinoline and a pyridine moiety. The presence of a bromine atom at the 6-position of the quinoline ring contributes to its reactivity and potential biological activity. The compound features an ethanone functional group, indicating it is a ketone, which can participate in various chemical reactions, such as nucleophilic additions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often associated with bioactive compounds. The compound's unique arrangement of atoms may influence its solubility, stability, and interaction with biological targets. Additionally, the presence of substituents like the methyl group on the pyridine ring can affect its electronic properties and steric hindrance, which are crucial for its reactivity and potential therapeutic effects. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C17H13BrN2O
InChI:InChI=1S/C17H13BrN2O/c1-11-3-2-4-16(20-11)17(21)9-12-7-8-19-15-6-5-13(18)10-14(12)15/h2-8,10H,9H2,1H3
InChI key:InChIKey=RJWSUIBCCYEGBN-UHFFFAOYSA-N
SMILES:C(C(=O)C=1N=C(C)C=CC1)C=2C3=C(N=CC2)C=CC(Br)=C3
Synonyms:
  • Ethanone, 2-(6-bromo-4-quinolinyl)-1-(6-methyl-2-pyridinyl)-
  • 2-(6-Bromo-4-quinolinyl)-1-(6-methyl-2-pyridinyl)ethanone
  • 2-(6-Bromoquinolin-4-yl)-1-(6-methylpyridin-2-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.