CymitQuimica logo

CAS 476472-56-7

:

2-(4-fluorophenyl)-1-(6-methylpyridin-2-yl)ethanone

Description:
2-(4-Fluorophenyl)-1-(6-methylpyridin-2-yl)ethanone, with the CAS number 476472-56-7, is an organic compound characterized by its unique structure, which includes a ketone functional group and two distinct aromatic systems. The presence of a fluorine atom on the phenyl ring enhances its electronic properties, potentially influencing its reactivity and interactions in various chemical environments. The methyl group on the pyridine ring contributes to the compound's steric and electronic characteristics, which can affect its solubility and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 2-(4-fluorophenyl)-1-(6-methylpyridin-2-yl)ethanone represents a versatile chemical entity with potential applications in various fields of research.
Formula:C14H12FNO
InChI:InChI=1/C14H12FNO/c1-10-3-2-4-13(16-10)14(17)9-11-5-7-12(15)8-6-11/h2-8H,9H2,1H3
SMILES:Cc1cccc(C(=O)Cc2ccc(cc2)F)n1
Synonyms:
  • Ethanone, 2-(4-Fluorophenyl)-1-(6-Methyl-2-Pyridinyl)-
  • 2-(4-Fluorophenyl)-1-(6-methylpyridin-2-yl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.