CAS 476490-05-8
:3-(2,4-dichlorophenyl)benzaldehyde
Description:
3-(2,4-Dichlorophenyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group attached to a phenyl ring that is further substituted with two chlorine atoms at the 2 and 4 positions. This compound typically appears as a pale yellow to light brown solid and is known for its distinct aromatic odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic nature. The presence of chlorine substituents enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate measures should be implemented to mitigate environmental impact.
Formula:C13H8Cl2O
InChI:InChI=1/C13H8Cl2O/c14-11-4-5-12(13(15)7-11)10-3-1-2-9(6-10)8-16/h1-8H
SMILES:c1cc(cc(c1)c1ccc(cc1Cl)Cl)C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
