CAS 4765-77-9
:6-Chloropyrimidin-4(3H)-one
Description:
6-Chloropyrimidin-4(3H)-one, with the CAS number 4765-77-9, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a carbonyl group. This compound features a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3, which contributes to its basicity and reactivity. The presence of the chlorine atom at the 6-position enhances its electrophilic character, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The carbonyl group at the 4-position is indicative of its keto form, which can participate in tautomeric shifts. 6-Chloropyrimidin-4(3H)-one is typically a solid at room temperature and is soluble in polar organic solvents. Its reactivity allows it to undergo various chemical transformations, including nucleophilic substitutions and cycloadditions, making it a valuable building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C4H3ClN2O
InChI:InChI=1/C4H3ClN2O/c5-3-1-4(8)7-2-6-3/h1-2H,(H,6,7,8)
SMILES:c1c(Cl)ncnc1O
Synonyms:- 6-Chloro-4-pyrimidinol
- 6-chloropyrimidin-4(1H)-one
- 4-Hydroxy-6-Chloropyrimidine
- 6-chloropyrimidin-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chloro-6-hydroxypyrimidine
CAS:Formula:C4H3ClN2OPurity:>98.0%(GC)(T)Color and Shape:White to Green to Brown powder to crystalMolecular weight:130.536-Chloro-4(1H)-Pyrimidinone
CAS:Formula:C4H3ClN2OPurity:97%Color and Shape:SolidMolecular weight:130.53244-Chloro-6-hydroxypyrimidine
CAS:4-Chloro-6-hydroxypyrimidineFormula:C4H3ClN2OPurity:98%Color and Shape:Light red. SolidMolecular weight:130.532426-Chloro-4-hydroxypyrimidine
CAS:Formula:C4H3ClN2OPurity:95%Color and Shape:SolidMolecular weight:130.534-Chloro-6-hydroxypyrimidine
CAS:4-Chloro-6-hydroxypyrimidine is an organic compound that is used as a precursor to other chemical compounds. It can be prepared by the reaction of ethylene with chlorine in the presence of carbon disulphide. 4-Chloro-6-hydroxypyrimidine has been shown to react with halides, amidines, and ethylene to form tritiated pyrimidines. It also reacts with disulphides, chlorinates and uracil. 4-Chloro-6-hydroxypyrimidine is reactive and can undergo desulfurization reactions with aluminium and malonate to form chloride or sulphoxide. The halides, amidines, and ethylene are all reactive substances that can react with each other or undergo other reactions to form new substances.
Formula:C4H3ClN2OPurity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow SolidMolecular weight:130.53 g/mol4-Chloro-6-hydroxypyrimidine
CAS:Controlled ProductFormula:C4H3ClN2OColor and Shape:NeatMolecular weight:130.53





