CymitQuimica logo

CAS 4766-33-0

:

5-bromonaphthalen-1-amine

Description:
5-Bromonaphthalen-1-amine is an organic compound characterized by the presence of a bromine atom and an amino group attached to a naphthalene ring system. It features a bromine substituent at the 5-position and an amino group at the 1-position of the naphthalene structure, which contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for participation in electrophilic aromatic substitution reactions, making it useful in the synthesis of more complex organic molecules. Additionally, the presence of the amino group can facilitate hydrogen bonding and influence the compound's physical properties, such as melting point and boiling point. 5-Bromonaphthalen-1-amine may also have applications in the fields of pharmaceuticals, agrochemicals, and materials science due to its functional groups, which can be further modified to create derivatives with specific properties. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H,12H2
InChI key:VNPCNUAYDOLBDR-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CC=C2N)C(=C1)Br
Synonyms:
  • 1-Naphthalenamine, 5-bromo-
  • 5-Bromo-Naphthalen-1-Ylamine
Found 5 products.