CAS 476620-20-9
:4,4,5,5-tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound contains a thiophene ring, which contributes to its aromatic properties and potential electronic applications. The presence of multiple methyl groups enhances its steric bulk and solubility, making it suitable for various synthetic applications, particularly in organic electronics and materials science. The dioxaborolane moiety is known for its ability to participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is valuable in the synthesis of complex organic molecules. Additionally, the compound's stability and reactivity can be influenced by the substituents on the thiophene ring and the boron center, making it a versatile building block in organic synthesis. Overall, this compound exemplifies the intersection of organometallic chemistry and functional organic materials, with potential applications in fields such as photovoltaics and organic semiconductors.
Formula:C11H17BO2S
InChI:InChI=1/C11H17BO2S/c1-8-6-15-7-9(8)12-13-10(2,3)11(4,5)14-12/h6-7H,1-5H3
SMILES:Cc1cscc1B1OC(C)(C)C(C)(C)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,4,5,5-Tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane
CAS:Formula:C11H17BO2SPurity:98%Color and Shape:SolidMolecular weight:224.12754-Methyl-3-thiopheneboronic acid pinacol ester
CAS:4,4,5,5-Tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolaneFormula:C11H17BO2SPurity:98%Molecular weight:224.134-Methylthiophene-3-boronic acid pinacol ester
CAS:4-Methylthiophene-3-boronic acid pinacol esterFormula:C11H17BO2SPurity:≥95%Molecular weight:224.127474,4,5,5-Tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane
CAS:Purity:98%(GC-MS);RGMolecular weight:224.13000494-Methylthiophene-3-boronic acid pinacol ester
CAS:4-Methylthiophene-3-boronic acid pinacol ester is a furan compound that can be used as an electron acceptor in organic devices. It has been shown to form anions with electron affinity and heteroaromatic properties. Experimental and theoretical studies have been conducted on the modification of 4-methylthiophene-3-boronic acid pinacol ester, including crystalline and silicon structures. Functional theory has also been applied to this molecule, which suggests that it functions as an electron donor and acceptor.Formula:C11H17BO2SPurity:Min. 95%Molecular weight:224.13 g/mol




