CymitQuimica logo

CAS 476683-65-5

:

4-amino-8-fluoro-quinoline-3-carboxylic acid

Description:
4-Amino-8-fluoro-quinoline-3-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of an amino group at the 4-position and a fluoro substituent at the 8-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry, particularly in the development of antimicrobial or antitumor agents. Its molecular structure allows for potential interactions with biological targets, and the presence of fluorine can influence its lipophilicity and metabolic stability. As with many quinoline derivatives, it may also exhibit fluorescence, which can be useful in analytical applications. Overall, 4-amino-8-fluoro-quinoline-3-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations in drug discovery.
Formula:C10H7FN2O2
InChI:InChI=1/C10H7FN2O2/c11-7-3-1-2-5-8(12)6(10(14)15)4-13-9(5)7/h1-4H,(H2,12,13)(H,14,15)
SMILES:c1cc2c(c(cnc2c(c1)F)C(=O)O)N
Synonyms:
  • 3-Quinolinecarboxylic acid, 4-amino-8-fluoro-
  • 4-Amino-8-fluoroquinoline-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.