CAS 4769-97-5
:4-Nitroindole
Description:
4-Nitroindole is an organic compound characterized by the presence of both an indole and a nitro functional group. It features a bicyclic structure consisting of a fused benzene and pyrrole ring, with a nitro group (-NO2) positioned at the 4-position of the indole ring. This compound typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as a building block in pharmaceuticals. 4-Nitroindole exhibits moderate solubility in organic solvents, such as ethanol and dimethyl sulfoxide, but is less soluble in water. The presence of the nitro group contributes to its electronic properties, making it a useful intermediate in various chemical reactions, including nitration and reduction processes. Additionally, 4-Nitroindole can participate in various biological activities, which has garnered interest in medicinal chemistry. However, handling this compound requires caution due to its potential toxicity and environmental impact.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c11-10(12)8-3-1-2-7-6(8)4-5-9-7/h1-5,9H
InChI key:InChIKey=LAVZKLJDKGRZJG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NC=C2)=CC=C1
Synonyms:- 1H-Indole, 4-nitro-
- 4-Nitro indole
- 4-Nitro-1H-indole
- Indole, 4-nitro-
- 4-Nitroindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Nitroindole
CAS:Formula:C8H6N2O2Purity:>98.0%(GC)Color and Shape:Orange to Brown powder to crystalMolecular weight:162.154-Nitro-1H-indole
CAS:4-Nitro-1H-indoleFormula:C8H6N2O2Purity:98%Color and Shape: dark yellow powderMolecular weight:162.15g/mol4-Nitroindole
CAS:<p>4-Nitroindole is a chemical compound that is used to synthesize 5-hydroxytryptamine (5-HT) and also has been used as a substitute for tryptophan in the synthesis of serotonin. It can be prepared by reacting sodium nitrite with an organic acid such as acetic acid or propionic acid. The reaction proceeds through a diazonium salt intermediate, which is hydrolyzed with hydrochloric acid to give 4-nitroindole. 4-Nitroindole can also be prepared by the Friedel-Crafts reaction between an aromatic nitro compound and an alkyl halide. The hydrogen bond between the hydroxyl group and nitrogen atom in the molecule makes it soluble in organic solvents. In addition, the constant boiling point of the compound allows it to be analyzed using gas chromatography.</p>Formula:C8H6N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:162.15 g/mol4-Nitroindole
CAS:Formula:C8H6N2O2Purity:97%Color and Shape:Solid, Yellow to orange powderMolecular weight:162.1484-Nitroindole
CAS:<p>4-Nitroindole is a versatile building block with a variety of applications. It can be used in the synthesis of complex compounds, research chemicals, and reagents. 4-Nitroindole is also useful in the synthesis of speciality chemicals and as an intermediate for the preparation of other compounds. This compound is high quality and has many uses as a reaction component or scaffold.</p>Formula:C8H6N2O2Molecular weight:162.15 g/mol





