CAS 477-47-4
:Picropodophyllin
Description:
Picropodophyllin is a naturally occurring lignan derived from the plant Podophyllum peltatum, commonly known as the mayapple. It is characterized by its complex chemical structure, which includes multiple aromatic rings and hydroxyl groups, contributing to its biological activity. Picropodophyllin exhibits antitumor properties and has been studied for its potential use in cancer therapy, particularly due to its ability to inhibit certain cellular processes involved in tumor growth. The compound is known to act as a potent inhibitor of the enzyme topoisomerase II, which is crucial for DNA replication and cell division. In addition to its anticancer effects, picropodophyllin has also shown promise in other therapeutic areas, including antiviral applications. Its solubility in organic solvents and limited water solubility can influence its bioavailability and pharmacokinetics. As with many bioactive compounds, further research is necessary to fully understand its mechanisms of action, therapeutic potential, and safety profile in clinical settings.
Formula:C22H22O8
InChI:InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19+,20-/m0/s1
InChI key:InChIKey=YJGVMLPVUAXIQN-HAEOHBJNSA-N
SMILES:O=C1[C@]2([C@@H](C=3C([C@H](O)[C@]2(CO1)[H])=CC4=C(C3)OCO4)C5=CC(OC)=C(OC)C(OC)=C5)[H]
Synonyms:- Picropodophyllin
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, [5R-(5α,5aα,8aα,9α)]-
- (-)Ppp
- Picropodophyllotoxin
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aS,8aR,9R)-
- (5R,5aS,8aR,9R)-5,8,8a,9-Tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
(5R,5As,8Ar,9R)-9-Hydroxy-5-(3,4,5-Trimethoxyphenyl)-5,8,8A,9-Tetrahydrofuro[3',4':6,7]Naphtho[2,3-D][1,3]Dioxol-6(5Ah)-One
CAS:(5R,5As,8Ar,9R)-9-Hydroxy-5-(3,4,5-Trimethoxyphenyl)-5,8,8A,9-Tetrahydrofuro[3',4':6,7]Naphtho[2,3-D][1,3]Dioxol-6(5Ah)-OnePurity:98%Molecular weight:414.41g/molPicropodophyllotoxin
CAS:Formula:C22H22O8Color and Shape:White To Off-White SolidMolecular weight:414.41Picropodophyllotoxin-d6
CAS:Formula:C22H16D6O8Color and Shape:White To Off-White SolidMolecular weight:420.45Picropodophyllin
CAS:Picropodophyllin (PPP) is a selective IGF-1R inhibitor with IC50 of 1 nM, not affecting other growth factor receptors.Formula:C22H22O8Purity:98.38% - 99.83%Color and Shape:SolidMolecular weight:414.41Ref: TM-T6943
5mg64.00€10mg88.00€25mg170.00€50mg316.00€100mg535.00€500mg1,121.00€1mL*10mM (DMSO)69.00€Picropodophyllin
CAS:Picropodophyllin is a semi-synthetic small molecule compound, which is derived from the natural podophyllotoxin isolated from the roots of Podophyllum species. It functions primarily as an insulin-like growth factor-1 receptor (IGF-1R) inhibitor, disrupting downstream signaling pathways that are essential for cellular proliferation and survival. By selectively inhibiting IGF-1R, picropodophyllin interferes with critical cellular processes, such as DNA synthesis and cell cycle progression, which are vital in oncogenic transformation.Formula:C22H22O8Purity:Min. 95%Color and Shape:White PowderMolecular weight:414.41 g/mol








