CAS 477-47-4: Picropodophyllin
Description:Picropodophyllin is a naturally occurring lignan derived from the plant Podophyllum peltatum, commonly known as the mayapple. It is characterized by its complex chemical structure, which includes multiple aromatic rings and hydroxyl groups, contributing to its biological activity. Picropodophyllin exhibits antitumor properties and has been studied for its potential use in cancer therapy, particularly due to its ability to inhibit certain cellular processes involved in tumor growth. The compound is known to act as a potent inhibitor of the enzyme topoisomerase II, which is crucial for DNA replication and cell division. In addition to its anticancer effects, picropodophyllin has also shown promise in other therapeutic areas, including antiviral applications. Its solubility in organic solvents and limited water solubility can influence its bioavailability and pharmacokinetics. As with many bioactive compounds, further research is necessary to fully understand its mechanisms of action, therapeutic potential, and safety profile in clinical settings.
Formula:C22H22O8
InChI:InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19+,20-/m0/s1
InChI key:InChIKey=YJGVMLPVUAXIQN-HAEOHBJNSA-N
SMILES:O=C1OCC2C(O)C3=CC=4OCOC4C=C3C(C5=CC(OC)=C(OC)C(OC)=C5)C12
- Synonyms:
- Picropodophyllin
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, [5R-(5α,5aα,8aα,9α)]-
- (-)Ppp
- Picropodophyllotoxin
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aS,8aR,9R)-
- (5R,5aS,8aR,9R)-5,8,8a,9-Tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one
![(5R,5As,8Ar,9R)-9-Hydroxy-5-(3,4,5-Trimethoxyphenyl)-5,8,8A,9-Tetrahydrofuro[3',4':6,7]Naphtho[2,3…](https://static.cymitquimica.com/products/54/thumb/OR1023240.jpg)
