CAS 4773-14-2
:2-(3-Aminopropyl)-1H-isoindole-1,3(2H)-dione
Description:
2-(3-Aminopropyl)-1H-isoindole-1,3(2H)-dione, also known by its CAS number 4773-14-2, is a chemical compound characterized by its isoindole structure, which features a bicyclic system comprising a five-membered ring fused to a six-membered ring. This compound contains an amino group (-NH2) attached to a propyl chain, contributing to its potential biological activity. The presence of the dione functional groups indicates that it has two carbonyl (C=O) functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to its functional groups. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their therapeutic properties. However, specific data regarding its reactivity, stability, and biological activity would require further investigation through experimental studies.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-5H,3,6-7,12H2
InChI key:InChIKey=SRMYNTUZHJDDER-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCCN)=CC=CC2
Synonyms:- N-(3-Aminopropyl)phthalimide
- 2-(3-Aminopropyl)isoindoline-1,3-dione
- 2-(3-Aminopropyl)-1H-isoindole-1,3(2H)-dione
- Phthalimide, N-(3-aminopropyl)-
- 1H-Isoindole-1,3(2H)-dione, 2-(3-aminopropyl)-
- 2-(3-aminopropyl)isoindole-1,3-dione hydrochloride
- N-(3-Aminopropyl)phthalimide HCl
- N-(3-AMINO-PROPYL)-PHTHALIMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
