CAS 4774-10-1

3-methoxypyrazin-2-amine

Description:

3-Methoxypyrazin-2-amine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methoxy group (-OCH3) and an amino group (-NH2) attached to the pyrazine ring, specifically at the 3 and 2 positions, respectively. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. 3-Methoxypyrazin-2-amine is often studied for its biological activity and may serve as a building block in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage, as with any chemical compound.

Formula: C₅H₇N₃O

InChI: InChI=1/C5H7N3O/c1-9-5-4(6)7-2-3-8-5/h2-3H,1H3,(H2,6,7)

SMILES: COc1c(N)nccn1

Synonyms:

• 2-Pyrazinamine, 3-methoxy-
• 2-Amino-3-Methoxypyrazine

3-Methoxypyrazin-2-amine

CAS: 4774-10-1

3-Methoxypyrazin-2-amine

Formula: C₅H₇N₃O

Purity: 98%

Molecular weight: 125.13

Ref: IN-DG69923

2-Amino-3-methoxypyrazine

CAS: 4774-10-1

Formula: C₅H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.1286

Ref: IN-DA00D8XD

3-Methoxypyrazin-2-amine

CAS: 4774-10-1

3-Methoxypyrazin-2-amine

Formula: C₅H₇N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 125.12858

Ref: 54-OR301247

3-Methoxypyrazin-2-amine

CAS: 4774-10-1

Formula: C₅H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.131

Ref: 10-F064494