CAS 477710-46-6
:Ethyl 1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylate
Description:
Ethyl 1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 4-fluorophenyl substituent enhances its biological activity and may influence its pharmacokinetic properties. The two methyl groups at the 3 and 5 positions of the pyrazole ring can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structure may confer specific properties such as anti-inflammatory or analgesic effects, although detailed biological activity would require empirical investigation. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C14H15FN2O2
InChI:InChI=1S/C14H15FN2O2/c1-4-19-14(18)13-9(2)16-17(10(13)3)12-7-5-11(15)6-8-12/h5-8H,4H2,1-3H3
InChI key:InChIKey=KRXPEHMOMPCHLF-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1C(OCC)=O)C2=CC=C(F)C=C2
Synonyms:- Ethyl 1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 1-(4-fluorophenyl)-3,5-dimethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylate
CAS:Ethyl 1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylateFormula:C14H15FN2O2Purity:techMolecular weight:262.2795

