CymitQuimica logo

CAS 477781-69-4

:

2,5,8,11-Tetraoxatridecan-13-ol, 1-phenyl-, methanesulfonate

Description:
2,5,8,11-Tetraoxatridecan-13-ol, 1-phenyl-, methanesulfonate is a chemical compound characterized by its complex structure, which includes a long carbon chain with multiple ether linkages and a phenyl group. The presence of tetraoxatridecane indicates that the molecule contains four ether (–O–) groups within a 13-carbon backbone, contributing to its solubility and potential applications in various chemical processes. The methanesulfonate group suggests that this compound may exhibit properties typical of sulfonates, such as increased water solubility and reactivity in nucleophilic substitution reactions. This compound may be of interest in fields such as organic synthesis, pharmaceuticals, or materials science due to its unique structural features. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the overall molecular interactions and the presence of functional groups. As with any chemical substance, safety data and handling precautions should be reviewed before use, particularly given the potential for biological activity or toxicity associated with certain sulfonate derivatives.
Formula:C16H26O7S
InChI:InChI=1S/C16H26O7S/c1-24(17,18)23-14-13-21-10-9-19-7-8-20-11-12-22-15-16-5-3-2-4-6-16/h2-6H,7-15H2,1H3
InChI key:DAODDIFNUYIKRO-UHFFFAOYSA-N
SMILES:CS(=O)(=O)OCCOCCOCCOCCOCC1=CC=CC=C1
Synonyms:
  • 1-Phenyl-2,5,8,11-Tetraoxatridecan-13-Yl Methanesulfonate
  • Bn-PEG4-OMes
Found 3 products.