CAS 477890-82-7

Formula: C38H36N2O6

InChI: InChI=1S/C38H36N2O6/c1-17-13-21-23-15-25(43-7)33(41)27(31(23)39-29(21)19-9-11-37(3,4)45-35(17)19)28-32-24(16-26(44-8)34(28)42)22-14-18(2)36-20(30(22)40-32)10-12-38(5,6)46-36/h9-16,39-42H,1-8H3

InChI key: DQRAEENKHHFBHV-UHFFFAOYSA-N

SMILES: CC1=CC2=C(C3=C1OC(C=C3)(C)C)NC4=C(C(=C(C=C24)OC)O)C5=C6C(=CC(=C5O)OC)C7=C(N6)C8=C(C(=C7)C)OC(C=C8)(C)C

8,8''-Biskoenigine

CAS: 477890-82-7

8,8''-Biskoenigine is a natural product for research related to life sciences. The catalog number is TN6197 and the CAS number is 477890-82-7.

Formula: C₃₈H₃₆N₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 616.7

Ref: TM-TN6197

8,8''-Biskoenigine

CAS: 477890-82-7

8,8''-Biskoenigine is a synthetic compound, which is derived from specific organic synthesis pathways tailored for precision biochemical applications. The source of this compound lies in advanced organic chemistry techniques that allow for the construction of complex molecular architectures. Its mode of action is primarily focused on its ability to engage in specific interactions at the molecular level, potentially influencing biochemical pathways or experimental settings.

Formula: C₃₈H₃₆N₂O₆

Purity: Min. 95%

Molecular weight: 616.7 g/mol

Ref: 3D-CUA89082