CymitQuimica logo

CAS 478148-60-6

:

Furo[2,3-c]pyridine-5-methanol

Description:
Furo[2,3-c]pyridine-5-methanol is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyridine and a furan moiety. This compound features a hydroxymethyl group (-CH2OH) at the 5-position of the pyridine ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of both nitrogen and oxygen in its structure allows for diverse interactions, making it a candidate for various biological activities. Furo[2,3-c]pyridine derivatives are often studied for their potential as pharmaceuticals, particularly in the development of compounds with anti-inflammatory, antimicrobial, or anticancer properties. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and its synthesis typically involves multi-step organic reactions. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining its chemical behavior and interactions with biological targets. Overall, Furo[2,3-c]pyridine-5-methanol represents a significant class of compounds in organic and medicinal chemistry research.
Formula:C8H7NO2
InChI:InChI=1S/C8H7NO2/c10-5-7-3-6-1-2-11-8(6)4-9-7/h1-4,10H,5H2
InChI key:UUKNFBHTKFKPEH-UHFFFAOYSA-N
SMILES:C1=COC2=CN=C(C=C21)CO
Synonyms:
  • Furo[2,3-c]pyridin-5-ylmethanol
Found 4 products.