CymitQuimica logo

CAS 478149-05-2

:

3-Thiophenamine, ethanedioate (1:1)

Description:
3-Thiophenamine, ethanedioate (1:1), with the CAS number 478149-05-2, is a chemical compound that features a thiophene ring substituted with an amino group and is associated with ethanedioic acid (oxalic acid) in a 1:1 stoichiometry. This compound typically exhibits characteristics common to both thiophene derivatives and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino group. The thiophene moiety contributes to its aromaticity and may influence its electronic properties, making it potentially useful in organic synthesis and materials science. The ethanedioate component suggests that the compound may form salts or complexes, which could affect its stability and reactivity. Additionally, the presence of both the thiophene and amino functionalities may impart biological activity, making it of interest in pharmaceutical research. Overall, the compound's properties would be influenced by its molecular structure, including aspects like polarity, reactivity, and potential interactions with other chemical species.
Formula:C4H5NS・C2H2O4
InChI:InChI=1S/C4H5NS.C2H2O4/c5-4-1-2-6-3-4;3-1(4)2(5)6/h1-3H,5H2;(H,3,4)(H,5,6)
InChI key:XBLAYFVCUPTTOI-UHFFFAOYSA-N
SMILES:C1=CSC=C1N.C(=O)(C(=O)O)O
Found 4 products.