CymitQuimica logo

CAS 478259-93-7

:

3-Pyridinecarbonitrile,1-[(4-fluorophenyl)methyl]-4-(2-furanyl)-1,2-dihydro-2-oxo-

Description:
3-Pyridinecarbonitrile, 1-[(4-fluorophenyl)methyl]-4-(2-furanyl)-1,2-dihydro-2-oxo- is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carbonitrile functional group, and a furan moiety. The presence of the 4-fluorophenyl group indicates that it has a fluorine substituent on the aromatic ring, which can influence its electronic properties and reactivity. This compound is likely to exhibit polar characteristics due to the nitrile and carbonyl functionalities, which can engage in hydrogen bonding and dipole interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. The compound's stability, solubility, and reactivity would depend on the specific conditions, such as pH and solvent, making it important for researchers to consider these factors in practical applications. Overall, this compound represents a unique combination of heterocyclic and aromatic features that may contribute to its functional properties in various chemical contexts.
Formula:C17H11FN2O2
InChI:InChI=1S/C17H11FN2O2/c18-13-5-3-12(4-6-13)11-20-8-7-14(15(10-19)17(20)21)16-2-1-9-22-16/h1-9H,11H2
InChI key:HPTBPWKSWJXOTL-UHFFFAOYSA-N
SMILES:C1=COC(=C1)C2=C(C(=O)N(C=C2)CC3=CC=C(C=C3)F)C#N
Found 1 products.