CymitQuimica logo

CAS 47910-79-2

:

L-Phenylalaninamide,L-tyrosyl-L-methionylglycyl-L-tryptophyl-L-methionyl-L-a-aspartyl-

Description:
L-Phenylalaninamide, L-tyrosyl-L-methionylglycyl-L-tryptophyl-L-methionyl-L-a-aspartyl- is a complex peptide composed of multiple amino acids, which are the building blocks of proteins. This substance is characterized by its specific sequence of amino acids, which influences its biological activity and properties. Peptides like this one often exhibit various functions in biological systems, including roles in signaling, enzyme activity, and structural support. The presence of aromatic amino acids such as phenylalanine and tyrosine suggests potential interactions with other biomolecules, while the inclusion of methionine and aspartic acid may contribute to its stability and solubility. The CAS number 47910-79-2 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. Overall, the characteristics of this peptide are determined by its amino acid composition, sequence, and the resulting three-dimensional structure, which ultimately dictate its biological functions and potential applications in fields such as biochemistry and pharmacology.
Formula:C45H57N9O10S2
InChI:InChI=1S/C45H57N9O10S2/c1-65-18-16-33(51-41(60)31(46)20-27-12-14-29(55)15-13-27)42(61)49-25-38(56)50-36(22-28-24-48-32-11-7-6-10-30(28)32)44(63)52-34(17-19-66-2)43(62)54-37(23-39(57)58)45(64)53-35(40(47)59)21-26-8-4-3-5-9-26/h3-15,24,31,33-37,48,55H,16-23,25,46H2,1-2H3,(H2,47,59)(H,49,61)(H,50,56)(H,51,60)(H,52,63)(H,53,64)(H,54,62)(H,57,58)/t31-,33-,34-,35-,36-,37-/m0/s1
InChI key:CRSGPVVFNHQALK-GIZYWFQPSA-N
SMILES:CSCC[C@@H](C(=O)NCC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N)NC(=O)[C@H](CC4=CC=C(C=C4)O)N
Found 3 products.