CymitQuimica logo

CAS 47922-48-5

:

(gln8)-luteinizing hormone*releasing hormone

Description:
(gln8)-Luteinizing hormone-releasing hormone (LHRH) is a synthetic analog of the naturally occurring gonadotropin-releasing hormone (GnRH), which plays a crucial role in regulating the reproductive hormone cascade. This peptide consists of a sequence of amino acids that includes an important modification at the eighth position, where glutamine (Gln) is substituted. This alteration enhances its stability and potency compared to the native hormone. The substance is typically used in research and clinical settings to study reproductive functions and to develop treatments for hormone-related disorders, such as certain cancers and infertility. Its mechanism of action involves binding to GnRH receptors in the pituitary gland, stimulating the release of luteinizing hormone (LH) and follicle-stimulating hormone (FSH), which are essential for reproductive health. The CAS number 47922-48-5 uniquely identifies this compound, facilitating its recognition in scientific literature and regulatory contexts. Overall, (gln8)-LHRH exemplifies the importance of peptide modifications in enhancing therapeutic efficacy in endocrinology.
Formula:C54H71N15O14
InChI:InChI=1/C54H71N15O14/c1-28(2)18-37(49(78)64-36(13-15-43(55)72)54(83)69-17-5-8-42(69)53(82)59-24-44(56)73)63-46(75)25-60-47(76)38(19-29-9-11-32(71)12-10-29)65-52(81)41(26-70)68-50(79)39(20-30-22-58-34-7-4-3-6-33(30)34)66-51(80)40(21-31-23-57-27-61-31)67-48(77)35-14-16-45(74)62-35/h3-4,6-7,9-12,22-23,27-28,35-42,58,70-71H,5,8,13-21,24-26H2,1-2H3,(H2,55,72)(H2,56,73)(H,57,61)(H,59,82)(H,60,76)(H,62,74)(H,63,75)(H,64,78)(H,65,81)(H,66,80)(H,67,77)(H,68,79)/t35-,36-,37-,38-,39-,40-,41-,42-/m0/s1
InChI key:WPKQYFUSPONRAT-BXXNOCLASA-N
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCC(=N)O)C(=O)N1CCC[C@H]1C(=NCC(=N)O)O)O)N=C(CN=C([C@H](Cc1ccc(cc1)O)N=C([C@H](CO)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](Cc1cnc[nH]1)N=C([C@@H]1CCC(=N1)O)O)O)O)O)O)O
Synonyms:
  • LHRH (chicken)
  • Pyr-His-Trp-Ser-Tyr-Gly-Leu-Gln-Pro-Gly-NH2
  • 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosylglycyl-L-leucyl-L-glutaminyl-L-prolylglycinamide
Found 4 products.