CymitQuimica logo

CAS 479500-35-1

:

1-Butyl-1-methylpyrrolidinium chloride

Description:
1-Butyl-1-methylpyrrolidinium chloride is an ionic liquid characterized by its unique structure, which consists of a pyrrolidinium cation with a butyl and a methyl group attached to the nitrogen atom, paired with a chloride anion. This compound is typically colorless to pale yellow and exhibits low volatility, making it an attractive alternative to traditional organic solvents. Its properties include a relatively low melting point, which allows it to remain in a liquid state at room temperature, and it is known for its high thermal stability. The presence of the butyl group contributes to its hydrophobic nature, while the pyrrolidinium structure enhances its solvation capabilities. This ionic liquid is often utilized in various applications, including electrochemistry, catalysis, and as a solvent for chemical reactions, due to its tunable properties and ability to dissolve a wide range of substances. Additionally, it is considered to have a lower environmental impact compared to conventional solvents, aligning with green chemistry principles.
Formula:C9H20N·Cl
InChI:InChI=1S/C9H20N.ClH/c1-3-4-7-10(2)8-5-6-9-10;/h3-9H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=BOOXKGZZTBKJFE-UHFFFAOYSA-M
SMILES:C(CCC)[N+]1(C)CCCC1.[Cl-]
Synonyms:
  • Butylmethylpyrrolidinium chloride
  • N-Butyl-N-methylpyrrolidinium chloride
  • Pyrrolidinium, 1-Butyl-1-Methyl-, Chloride (1:1)
  • Pyrrolidinium, 1-butyl-1-methyl-, chloride
  • [Bmpyr]Cl
  • 1-Butyl-1-methylpyrrolidinium chloride
Found 6 products.