CAS 480-66-0: 2′,4′,6′-Trihydroxyacetophenone
Description:2′,4′,6′-Trihydroxyacetophenone, with the CAS number 480-66-0, is an organic compound that belongs to the class of phenolic compounds. It features three hydroxyl (-OH) groups positioned at the 2, 4, and 6 positions of the acetophenone structure, which contributes to its chemical reactivity and solubility properties. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. Its hydroxyl groups make it a potent antioxidant and it is often studied for its potential applications in pharmaceuticals, cosmetics, and as a chemical intermediate. The presence of multiple hydroxyl groups enhances its ability to form hydrogen bonds, influencing its physical properties and interactions with other molecules. Additionally, 2′,4′,6′-Trihydroxyacetophenone exhibits UV absorbance, making it useful in various analytical applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-4(9)8-6(11)2-5(10)3-7(8)12/h2-3,10-12H,1H3
InChI key:InChIKey=XLEYFDVVXLMULC-UHFFFAOYSA-N
SMILES:O=C(C=1C(O)=CC(O)=CC1O)C
- Synonyms:
- 1-(2,4,6-Trihydroxyphenyl)ethan-1-one
- 1-(2,4,6-Trihydroxyphenyl)ethanone
- 2',4',6'-Trihydroxyacetophenone
- 2,4,6-Trihydroxyacetophenone
- 2,4,6-Trihydroxylacetophenone Monohydrate
- 2-Acetyl-1,3,5-benzenetriol
- 2-Acetyl-1,3,5-trihydroxybenzene
- 2-Acetylphloroglucinol
- Acetophenone, 2′,4′,6′-trihydroxy-
- Acetophloroglucine
- See more synonyms
- Acetylphloroglucinol
- Ethanone, 1-(2,4,6-trihydroxyphenyl)-
- NSC 54927
- Phloracetophene
- Phloracetophenone
- Phloroacetophenone
