CymitQuimica logo

CAS 480424-49-5

:

(3-formyl-2-methoxyphenyl)boronic acid

Description:
(3-formyl-2-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a formyl and a methoxy substituent. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents due to the presence of the boronic acid group, which can engage in hydrogen bonding. The formyl group contributes to its reactivity, allowing it to participate in various organic reactions, including condensation and coupling reactions, making it valuable in synthetic organic chemistry. The methoxy group enhances the electron-donating properties of the phenyl ring, influencing its reactivity and stability. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which is significant in applications such as drug delivery and sensor development. Overall, (3-formyl-2-methoxyphenyl)boronic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C8H9BO4
InChI:InChI=1/C8H9BO4/c1-13-8-6(5-10)3-2-4-7(8)9(11)12/h2-5,11-12H,1H3
InChI key:DUROSIJIMLRFHR-UHFFFAOYSA-N
SMILES:COc1c(cccc1B(O)O)C=O
Synonyms:
  • boronic acid, B-(3-formyl-2-methoxyphenyl)-
  • 3-Formyl-2-Methoxybenzeneboronic Acid
Found 5 products.