CymitQuimica logo

CAS 480438-61-7

:

(2-butoxy-4-fluorophenyl)boronic acid

Description:
(2-butoxy-4-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a butoxy group, providing hydrophobic characteristics, and a fluorophenyl moiety, which can influence its electronic properties and reactivity. The boronic acid group imparts acidity, allowing it to participate in various chemical reactions, including Suzuki coupling, which is essential for forming carbon-carbon bonds. The presence of the fluorine atom can enhance the compound's stability and lipophilicity, potentially affecting its biological activity. In terms of physical properties, boronic acids typically exhibit moderate solubility in polar solvents and can form stable complexes with certain ligands. Overall, (2-butoxy-4-fluorophenyl)boronic acid is a versatile compound with applications in pharmaceuticals and materials science, particularly in the development of new synthetic methodologies.
Formula:C10H14BFO3
InChI:InChI=1/C10H14BFO3/c1-2-3-6-15-10-7-8(12)4-5-9(10)11(13)14/h4-5,7,13-14H,2-3,6H2,1H3
InChI key:PLWSVNYQYXGJJG-UHFFFAOYSA-N
SMILES:CCCCOc1cc(ccc1B(O)O)F
Found 3 products.