CymitQuimica logo

CAS 4815-35-4

:

2-amino-5-phenylthiophene-3-carboxamide

Description:
2-Amino-5-phenylthiophene-3-carboxamide, with the CAS number 4815-35-4, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) that contribute to its polar nature, enhancing its solubility in polar solvents. The presence of the phenyl group (a benzene ring) attached to the thiophene enhances its aromatic character and may influence its electronic properties. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to participate in various chemical reactions. Its structural features suggest that it may exhibit properties such as fluorescence or conductivity, depending on the specific conditions and substituents present. Additionally, the compound's reactivity can be attributed to the functional groups, making it a candidate for further chemical modifications or applications in drug development.
Formula:C11H10N2OS
InChI:InChI=1/C11H10N2OS/c12-10(14)8-6-9(15-11(8)13)7-4-2-1-3-5-7/h1-6H,13H2,(H2,12,14)
InChI key:UHEGYTDIDBFUJD-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cc(C(=N)O)c(N)s1
Synonyms:
  • 2-Amino-5-phenyl-thiophene-3-carboxylic acid amide
  • 3-Thiophenecarboxamide, 2-Amino-5-Phenyl-
Found 5 products.