CymitQuimica logo

CAS 4816-81-3

:

N-(p-Toluenesulfonyl)-DL-alanine

Description:
N-(p-Toluenesulfonyl)-DL-alanine, commonly referred to as Tosyl-DL-alanine, is an organic compound characterized by the presence of a toluenesulfonyl group attached to the amino acid alanine. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its ionic and polar characteristics. The toluenesulfonyl group enhances the compound's reactivity, making it useful in various chemical reactions, particularly in peptide synthesis and as a protecting group in organic synthesis. Its molecular structure includes both an amino group and a carboxylic acid group, which are characteristic of amino acids, allowing it to participate in typical amino acid reactions. Additionally, the presence of the sulfonyl group can influence the compound's physical properties, such as melting point and stability. Safety data indicates that, like many sulfonyl compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C10H12NO4S
InChI:InChI=1/C10H13NO4S/c1-7-3-5-9(6-4-7)16(14,15)11-8(2)10(12)13/h3-6,8,11H,1-2H3,(H,12,13)/p-1/t8-/m1/s1
InChI key:LQXKHFZRJYXXFA-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)N[C@H](C)C(=O)[O-]
Synonyms:
  • Alanine, N-[(4-methylphenyl)sulfonyl]-
  • N-[(4-Methylphenyl)sulfonyl]alanine
  • (2S)-2-{[(4-methylphenyl)sulfonyl]amino}propanoate
  • (2R)-2-{[(4-methylphenyl)sulfonyl]amino}propanoate
Found 4 products.