CAS 483-15-8
:Dihydroberberine
Description:
Dihydroberberine is a chemical compound that belongs to the class of isoquinoline alkaloids, specifically derived from berberine, which is known for its various biological activities. It is characterized by its molecular structure, which includes a tetrahydroisoquinoline framework, resulting from the reduction of the double bond in the berberine molecule. Dihydroberberine is often studied for its potential pharmacological effects, including its role in glucose metabolism and its possible benefits in managing metabolic disorders. It exhibits antioxidant properties and may influence lipid metabolism, making it of interest in research related to cardiovascular health and diabetes. The compound is typically found in various plant sources and can be synthesized in the laboratory. Its solubility and stability can vary depending on the conditions, and it is often analyzed using techniques such as chromatography. Overall, dihydroberberine represents a promising area of study in natural product chemistry and pharmacology, with ongoing research into its therapeutic applications.
Formula:C20H19NO4
InChI:InChI=1S/C20H19NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-9H,5-6,10-11H2,1-2H3
InChI key:InChIKey=FZAGOOYMTPGPGF-UHFFFAOYSA-N
SMILES:O(C)C1=C2CN3C(C=4C(=CC5=C(C4)OCO5)CC3)=CC2=CC=C1OC
Synonyms:- 5,8-Dihydro-9,10-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizine
- 6H-1,3-benzodioxolo[5,6-a]benzo[g]quinolizine, 5,8-dihydro-9,10-dimethoxy-
- 6H-Benzo[g]-1,3-benzodioxolo[5,6-a]quinolizine, 5,8-dihydro-9,10-dimethoxy-
- 7,8-Dihydroberberine
- 9,10-Dimethoxy-5,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinoline
- Berberine, dihydro-
- Berbine, 13,13a-didehydro-9,10-dimethoxy-2,3-(methylenedioxy)-
- Dihydroumbellatine
- NSC 331264
- Dihydroberberine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
9,10-Dimethoxy-6,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinoline
CAS:Formula:C20H19NO4Purity:95%Molecular weight:337.3692Dihydroberberine
CAS:Dihydroberberine has anti-atherosclerotic, anti-inflammatory, hypolipidemic and antitumor activities.Formula:C20H19NO4Purity:93.77%Color and Shape:SolidMolecular weight:337.37Dihydroberberine
CAS:Natural alkaloidFormula:C20H19NO4Purity:≥ 90.0 % (HPLC)Color and Shape:CrystalsMolecular weight:337.38Dihydroberberine
CAS:Controlled Product<p>Applications Dihydroberberine is a derivative Berberine (B318150), an isoqinoline alkaloid shown to have a chemopreventive property against colon tumor formation by inhibiting the enzyme cyclooxygenase-2 (cox-2) which is abundantly expressed in colon cancer cells.<br>References Zhang, X. et al.: Cancer Res., 70, 9895 (2010); Lin, H.L. et al.: Cancer 85, 1937(1999); Schumacher, M.A. et al.: Science, 294, 2158 (2001); Fukuda, K. et al.: J. Ethno., 66, 227(1999);<br></p>Formula:C20H19NO4Color and Shape:NeatMolecular weight:337.369Dihydroberberine
CAS:<p>Dihydroberberine is an alkaloid compound, which is a derivative of berberine obtained through hydrogenation. This transformation enhances its bioavailability and efficacy. Dihydroberberine is sourced primarily from the roots, stems, and bark of several plants traditionally used in herbal medicine, including members of the Berberidaceae family. The mode of action involves the regulation of glucose and lipid metabolism through activation of the AMP-activated protein kinase (AMPK) pathway, which is essential for maintaining cellular energy homeostasis.</p>Formula:C20H19NO4Purity:Min. 95%Molecular weight:337.37 g/mol








