CAS 4832-52-4
:tris(phenylthio)methane
Description:
Tris(phenylthio)methane, with the CAS number 4832-52-4, is an organic compound characterized by its unique structure, which features a central carbon atom bonded to three phenylthio groups. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to the presence of the bulky phenyl groups. It is known for its stability and low reactivity under standard conditions, making it useful in various chemical applications. Tris(phenylthio)methane is often employed as a reagent in organic synthesis and can act as a ligand in coordination chemistry. Its properties include solubility in organic solvents, which facilitates its use in diverse chemical reactions. Additionally, the compound may exhibit interesting optical properties due to the presence of the phenyl groups, which can influence its behavior in photochemical processes. Safety data should be reviewed before handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C19H16S3
InChI:InChI=1/C19H16S3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15,19H
InChI key:YOQHDHPBEXTHCP-UHFFFAOYSA-N
SMILES:c1ccc(cc1)SC(Sc1ccccc1)Sc1ccccc1
Synonyms:- Triphenyl Trithioorthoformate
- 1,1',1''-(Methanetriyltrisulfanediyl)Tribenzene
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Tris(phenylthio)methane
CAS:Formula:C19H16S3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:340.52Tris(phenylthio)methane
CAS:Tris(phenylthio)methane is a formylating reagent that reacts with ethyl formate to produce the nitro compound. It is used in the preparation of β-amino acids and as an asymmetric synthesis catalyst. Tris(phenylthio)methane can be used as a polymerization initiator for metathesis reactions, such as the Suzuki reaction. It has been shown to be a good nucleophile and polymerizing agent when combined with hydrochloric acid or silver trifluoromethanesulfonate. Tris(phenylthio)methane may also react with chloride in the presence of base to produce phosphoric acid esters.
Formula:C19H16S3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:340.53 g/mol





