CAS 483367-10-8: Purmorphamine
Description:Purmorphamine is a synthetic small molecule that belongs to the class of compounds known as morpholines. It is primarily recognized for its role in promoting osteogenic differentiation, making it of interest in regenerative medicine and stem cell research. Purmorphamine acts as a potent agonist of the Hedgehog signaling pathway, which is crucial for various developmental processes, including bone formation and repair. The compound has been studied for its potential applications in enhancing bone regeneration and treating conditions such as osteoporosis. In terms of its chemical structure, Purmorphamine features a morpholine ring, which contributes to its biological activity. It is typically characterized by its solubility in organic solvents and its stability under standard laboratory conditions. As with many bioactive compounds, careful consideration of its dosage and potential side effects is essential in research and therapeutic contexts. Overall, Purmorphamine represents a significant advancement in the exploration of small molecules for tissue engineering and regenerative therapies.
Formula:C31H32N6O2
InChI:InChI=1S/C31H32N6O2/c1-2-9-25(10-3-1)37-21-32-28-29(33-23-13-15-24(16-14-23)36-17-19-38-20-18-36)34-31(35-30(28)37)39-27-12-6-8-22-7-4-5-11-26(22)27/h4-8,11-16,21,25H,1-3,9-10,17-20H2,(H,33,34,35)
InChI key:InChIKey=FYBHCRQFSFYWPY-UHFFFAOYSA-N
SMILES:N1=CN(C=2N=C(N=C(NC3=CC=C(C=C3)N4CCOCC4)C12)OC5=CC=CC=6C=CC=CC56)C7CCCCC7
- Synonyms:
- 2-(1-Naphthoxy)-6-(4-morpholinoanilino)-9-cyclohexylpurine
- 9-Cyclohexyl-N-[4-(4-morpholinyl)phenyl]-2-(1-naphthalenyloxy)-9H-purin-6-amine
- 9H-Purin-6-amine, 9-cyclohexyl-N-[4-(4-morpholinyl)phenyl]-2-(1-naphthalenyloxy)-
- Purmorphamine
