CAS 4836-13-9: N4-Benzoyl-2′-deoxycytidine
Description:N4-Benzoyl-2′-deoxycytidine, with the CAS number 4836-13-9, is a modified nucleoside that features a benzoyl group attached to the nitrogen atom at the 4-position of the cytidine base. This compound is characterized by its structural components, which include a deoxyribose sugar and a pyrimidine base, specifically cytidine. The benzoyl modification enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and molecular biology. N4-Benzoyl-2′-deoxycytidine is often studied for its potential applications in antiviral and anticancer therapies, as modifications to nucleosides can affect their interaction with nucleic acids and enzymes. Additionally, this compound may exhibit unique solubility and stability properties compared to unmodified nucleosides, which can be advantageous in drug formulation and delivery. Its synthesis typically involves the acylation of 2′-deoxycytidine, and it can be analyzed using various spectroscopic techniques to confirm its structure and purity.
Formula:C16H17N3O5
InChI:InChI=1S/C16H17N3O5/c20-9-12-11(21)8-14(24-12)19-7-6-13(18-16(19)23)17-15(22)10-4-2-1-3-5-10/h1-7,11-12,14,20-21H,8-9H2,(H,17,18,22,23)/t11-,12+,14+/m0/s1
InChI key:InChIKey=MPSJHJFNKMUKCN-OUCADQQQSA-N
SMILES:O=C1N=C(C=CN1C2OC(CO)C(O)C2)NC(=O)C=3C=CC=CC3
- Synonyms:
- 4-(benzoylamino)-1-(2-deoxy-beta-L-erythro-pentofuranosyl)pyrimidin-2(1H)-one
- 4-N-Benzoyldeoxycytidine
- Benzamide, N-[1-(2-deoxy-β-<span class="text-smallcaps">D</span>-erythro-pentofuranosyl)-1,2-dihydro-2-oxo-4-pyrimidinyl]-
- Cytidine, N-benzoyl-2′-deoxy-
- N-Benzoyl-2′-deoxycytidine
- N-Benzoyldeoxycytidine
- N4-Benzoyl-2'-deoxycytidine
- N<sup>4</sup>-Benzoyl-2′-deoxycytidine
- N<sup>4</sup>-Benzoyldeoxycytidine
- Benzamide, N-[1-(2-deoxy-β-D-erythro-pentofuranosyl)-1,2-dihydro-2-oxo-4-pyrimidinyl]-
- See more synonyms
- N4-Benzoyldeoxycytidine
- N-Benzoyl-2-Deoxy-Cytidine
- Bz-dC
