CAS 484-14-0
:Osthenol
Description:
Osthenol, with the CAS number 484-14-0, is a naturally occurring chemical compound classified as a flavonoid. It is primarily derived from various plant sources and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. Osthenol exhibits a complex structure characterized by multiple aromatic rings and hydroxyl groups, which contribute to its reactivity and interaction with biological systems. The compound is often studied for its pharmacological potential, particularly in the context of traditional medicine and herbal remedies. In addition to its health-related applications, osthenol may also play a role in plant defense mechanisms, helping to protect against pathogens and environmental stressors. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in experimental settings. Overall, osthenol represents a significant area of interest in both natural product chemistry and medicinal research.
Formula:C14H14O3
InChI:InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3
InChI key:InChIKey=RAKJVIPCCGXHHS-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1=C2C(=CC=C1O)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 7-hydroxy-8-(3-methyl-2-butenyl)-
- 2H-1-Benzopyran-2-one, 7-hydroxy-8-(3-methyl-2-buten-1-yl)-
- Coumarin, 7-hydroxy-8-(3-methyl-2-butenyl)-
- 7-Hydroxy-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one
- Osthenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Osthenol
CAS:Osthenol: Natural, selective hMAO-A inhibitor with antitumor, antifungal, and antibacterial properties. Ki=0.26 μM.Formula:C14H14O3Purity:97.23%Color and Shape:SolidMolecular weight:230.26Ref: TM-TN1120
1mg96.00€5mg187.00€10mg283.00€25mg467.00€50mg682.00€100mg939.00€1mL*10mM (DMSO)200.00€Osthenol
CAS:Osthenol is a natural product compound, known for its osteogenic-promoting properties. It is derived from plant sources, specifically from the fruits of Cudrania tricuspidata, a member of the Moraceae family. This compound functions by modulating cellular activities associated with bone formation. Osthenol has been reported to promote the differentiation and maturation of osteoblasts, the bone-forming cells, through the activation of specific signaling pathways such as the BMP-2 and Wnt/β-catenin pathways. These pathways are crucial for enhancing the deposition of extracellular matrix and increasing the expression of osteogenic markers.Formula:C14H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:230.26 g/mol





