CAS 484-78-6: 3-Hydroxykynurenine
Description:3-Hydroxykynurenine is an organic compound that belongs to the kynurenine pathway, which is a significant metabolic route for the amino acid tryptophan. It is characterized by its hydroxyl group (-OH) attached to the aromatic ring of the kynurenine structure, which contributes to its biological activity. This compound is known for its role in various physiological processes, including neuroprotection and modulation of immune responses. It exhibits antioxidant properties, which may help in protecting cells from oxidative stress. Additionally, 3-hydroxykynurenine has been studied for its potential involvement in neurodegenerative diseases, as it can influence neurotransmitter levels and neuronal health. The compound is soluble in water and organic solvents, making it versatile for various biochemical applications. Its CAS number, 484-78-6, is a unique identifier that facilitates its recognition in scientific literature and databases. Overall, 3-hydroxykynurenine is a significant molecule in biochemistry and pharmacology, with ongoing research into its therapeutic potential.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)
InChI key:InChIKey=VCKPUUFAIGNJHC-UHFFFAOYSA-N
SMILES:O=C(O)C(N)CC(=O)C=1C=CC=C(O)C1N
- Synonyms:
- 2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoicacid
- 3-Hydroxy-<span class="text-smallcaps">DL</span>-kynurenine
- 3-Hydroxykynurenine
- 484-78-6
- <span class="text-smallcaps">DL</span>-3-Hydroxykynurenine
- Alanine, 3-(3-hydroxyanthraniloyl)-
- Benzenebutanoic acid, α,2-diamino-3-hydroxy-γ-oxo-
- Hydroxykynurenine
- α,2-Diamino-3-hydroxy-γ-oxobenzenebutanoic acid
