CAS 4856-97-7
:1H-Benzimidazole-2-methanol
Description:
1H-Benzimidazole-2-methanol, with the CAS number 4856-97-7, is an organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. This compound features a hydroxymethyl group (-CH2OH) at the 2-position of the benzimidazole ring, contributing to its chemical reactivity and potential applications. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and formulations. The presence of the hydroxymethyl group allows for hydrogen bonding, influencing its physical properties and interactions with biological systems. 1H-Benzimidazole-2-methanol is of interest in medicinal chemistry due to its potential pharmacological activities, including antimicrobial and antifungal properties. Its structural features also make it a candidate for further derivatization, leading to the development of novel compounds with enhanced biological activity. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c11-5-8-9-6-3-1-2-4-7(6)10-8/h1-4,11H,5H2,(H,9,10)
InChI key:InChIKey=IAJLTMBBAVVMQO-UHFFFAOYSA-N
SMILES:C(O)C=1NC=2C(N1)=CC=CC2
Synonyms:- (1H-1,3-Benzodiazol-2-yl)methanol
- (1H-Benzo[d]imidazol-2-yl)methanol
- (1H-Benzoimidazol-2-Yl)-Methanol
- 1H-1,3-Benzodiazol-2-ylmethanol
- 1H-Benzimidazol-2-Ylmethanol
- 2-(Hydroxymethyl)-1H-Benzimidazole
- 2-(Hydroxymethyl)benzimidazole
- 2-Benzimidazolemethanol
- 2-Hydroxymethylbenzimidazole
- Benzimidazole-2-Methanol
- Iflab-Bb F0266-0027
- NSC 18284
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Hydroxymethyl)benzimidazole
CAS:Formula:C8H8N2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:148.172-(Hydroxymethyl)-1H-benzimidazole
CAS:2-(Hydroxymethyl)-1H-benzimidazoleFormula:C8H8N2OPurity:97%Color and Shape:Beige SolidMolecular weight:148.16192(1H-Benzoimidazol-2-yl)methanol
CAS:Formula:C8H8N2OPurity:97%Color and Shape:SolidMolecular weight:148.16192-(Hydroxymethyl)benzimidazole
CAS:2-(Hydroxymethyl)benzimidazole is a hydroxylated analog of benzimidazole. It has been shown to inhibit the growth of cancer cells in cell culture, as well as human syncytial virus infection. 2-Hydroxymethylbenzimidazole also inhibits the activity of several enzymes, such as tetranuclear myocardin and hydrogen bond formation with copper (II). The chemical structure of 2-hydroxymethylbenzimidazole is a chelate ring with two coordinating atoms (copper, II) that are bound to each other by two hydrogen bonds. This coordination geometry is sensitive to changes in pH, which may affect the biological properties of this compound.Formula:C8H8N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:148.16 g/mol1H-Benzimidazole-2-methanol
CAS:Formula:C8H8N2OPurity:97%Color and Shape:Chunks,Crystalline PowderMolecular weight:148.165




