CymitQuimica logo

CAS 485807-08-7

:

3-Isoxazolecarboxylic acid, 5-amino-, ethyl ester

Description:
3-Isoxazolecarboxylic acid, 5-amino-, ethyl ester is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a bioactive molecule. The ethyl ester moiety enhances its solubility and may influence its pharmacokinetic properties. Typically, compounds of this nature are studied for their biological activities, including potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of the isoxazole ring often suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and solubility can vary based on environmental conditions and the presence of other functional groups. Overall, 3-Isoxazolecarboxylic acid, 5-amino-, ethyl ester represents a versatile structure with implications in various fields of research and development.
Formula:C6H8N2O3
InChI:InChI=1S/C6H8N2O3/c1-2-10-6(9)4-3-5(7)11-8-4/h3H,2,7H2,1H3
InChI key:AUERXJBPNRKJCS-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NOC(=C1)N
Found 5 products.