CymitQuimica logo

CAS 486422-11-1

:

Boronic acid, [4-[(4-methyl-1-piperazinyl)sulfonyl]phenyl]-

Description:
Boronic acid, specifically 4-[(4-methyl-1-piperazinyl)sulfonyl]phenyl- (CAS 486422-11-1), is an organic compound characterized by the presence of a boronic acid functional group, which typically features a boron atom bonded to a hydroxyl group and an aryl group. This compound contains a phenyl ring substituted with a sulfonyl group and a piperazine moiety, contributing to its potential biological activity. The piperazine ring enhances solubility and may influence pharmacological properties. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including drug development and materials science. The sulfonyl group can enhance the compound's stability and reactivity, while the methyl substitution on the piperazine ring may affect its interaction with biological targets. Overall, this compound's unique structure suggests potential utility in medicinal chemistry, particularly in the design of inhibitors or modulators of biological pathways.
Formula:C11H17BN2O4S
InChI:InChI=1S/C11H17BN2O4S/c1-13-6-8-14(9-7-13)19(17,18)11-4-2-10(3-5-11)12(15)16/h2-5,15-16H,6-9H2,1H3
InChI key:WTIRVOVQNGLJIQ-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C)(O)O
Found 2 products.