CAS 487-21-8
:Lumazine
Description:
Lumazine, with the CAS number 487-21-8, is a heterocyclic compound characterized by its bicyclic structure that includes a fused pyrimidine and imidazole ring. It is a colorless to pale yellow crystalline solid that is soluble in polar solvents such as water and alcohols. Lumazine is known for its role as a precursor in the biosynthesis of riboflavin (vitamin B2) and is involved in various biological processes. The compound exhibits fluorescence, making it of interest in photochemical applications and studies related to light absorption and emission. Its chemical formula is C7H6N4, and it has a relatively low molecular weight. Lumazine can participate in various chemical reactions, including condensation and oxidation, which can lead to the formation of more complex molecules. Due to its biological significance and unique structural properties, lumazine is studied in fields such as biochemistry, pharmacology, and materials science.
Formula:C6H4N4O2
InChI:InChI=1S/C6H4N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1-2H,(H2,8,9,10,11,12)
InChI key:InChIKey=UYEUUXMDVNYCAM-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC(=O)N1)NC=CN2
Synonyms:- 1,2,3,4-Tetrahydropteridine-2,4-dione
- 1H-Pteridine-2,4-dione
- 2,3,4,8-Tetrahydropteridine-2,4-dione
- 2,4(1H,3H)-Pteridinedione
- 2,4(3H,8H)-Pteridinedione
- 2,4-Dihydroxypteridine
- 2,4-Pteridinediol
- Lumazin
- Lumazine Monohydrate
- NSC 225113
- NSC 41801
- Pteridine-2,4-Diol Monohydrate
- Pteridine-2,4-dione
- pteridine-2,4(1H,3H)-dione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Lumazine
CAS:Formula:C6H4N4O2Purity:>99.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:164.12Pteridine-2,4(1H,3H)-dione
CAS:Pteridine-2,4(1H,3H)-dioneFormula:C6H4N4O2Purity:≥98%Molecular weight:164.12Pteridine-2,4(1H,3H)-dione
CAS:Pteridine-2,4(1H,3H)-dioneFormula:C6H4N4O2Purity:98%Molecular weight:164.122,4(1H,3H)-Pteridinedione
CAS:Formula:C6H4N4O2Purity:98%Color and Shape:SolidMolecular weight:164.1216Lumazine
CAS:LumazineFormula:C6H4N4O2Purity:>99.0%Color and Shape:Solid-PowderMolecular weight:164.12155Pteridine-2,4(1H,3H)-dione
CAS:Pteridine-2,4(1H,3H)-dione (Lumazine) is a new MALDI matrix for complex (phospho)lipid mixtures analysis.Formula:C6H4N4O2Purity:99.56%Color and Shape:Light Yellow To °Chre PowderMolecular weight:164.122,4-(1H,3H)-Pteridinedione
CAS:2,4-(1H,3H)-Pteridinedione is a heterocyclic organic compound, which is a synthetic derivative of pteridine found in various natural biochemical pathways. This compound acts primarily by participating in redox reactions due to its unique structural properties that allow electron transfer. Its structure consists of a fused-ring system capable of interconverting between oxidized and reduced states, making it valuable for studying electron transport systems.
Formula:C6H4N4O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:164.12 g/molLumazine
CAS:Controlled ProductApplications Lumazine is a new MALDI matrix for complex (phospho)lipid mixtures analysis.
References Kaufmann, R., et al.: Anal. Biochem., 238, 117 (1996); Fuchs, B., et al.: Anal. Bioanal. Chem.,389, 827 (2007); Cioffi, N., et al.: Anal. Bioanal. Chem., 394, 1375 (2009);Formula:C6H4N4O2Color and Shape:NeatMolecular weight:164.12







