CAS 4872-58-6
:5-Isoxazolecarboxylic acid, 4,5-dihydro-3-phenyl-
Description:
5-Isoxazolecarboxylic acid, 4,5-dihydro-3-phenyl- (CAS 4872-58-6) is an organic compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the phenyl group enhances its aromatic characteristics and may influence its reactivity and solubility. Typically, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The isoxazole moiety is known for its role in various pharmacological applications, including anti-inflammatory and antimicrobial properties. In terms of physical properties, such compounds may be solid at room temperature and exhibit moderate solubility in polar solvents. The specific reactivity and applications of 5-Isoxazolecarboxylic acid, 4,5-dihydro-3-phenyl- would depend on its molecular interactions and the presence of substituents that can affect its behavior in chemical reactions.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c12-10(13)9-6-8(11-14-9)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,12,13)
InChI key:HUFSZQCZMWZMKT-UHFFFAOYSA-N
SMILES:C1C(ON=C1C2=CC=CC=C2)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Phenyl-4,5-dihydroisoxazole-5-carboxylic acid
CAS:3-Phenyl-4,5-dihydroisoxazole-5-carboxylic acidFormula:C10H9NO3Purity:95%Molecular weight:191.183-Phenyl-4,5-Dihydroisoxazole-5-Carboxylic Acid
CAS:Formula:C10H9NO3Purity:95%Color and Shape:SolidMolecular weight:191.18343-Phenyl-4,5-dihydroisoxazole-5-carboxylic acid
CAS:3-Phenyl-4,5-dihydroisoxazole-5-carboxylic acid is a fine chemical that is used as a building block in the synthesis of other chemicals. This compound can be used in research and development as a reagent for organic synthesis or as an intermediate for the production of high quality, complex compounds. 3-Phenyl-4,5-dihydroisoxazole-5-carboxylic acid is also a versatile building block that can be used in reactions involving amines, alcohols, carboxylic acids, sulfonic acids, and nitriles. It could also be used as a scaffold molecule to create complex molecules with interesting properties.Formula:C10H9NO3Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:191.18 g/mol3-phenyl-4,5-dihydroisoxazole-5-carboxylic acid
CAS:Formula:C10H9NO3Purity:95%Color and Shape:SolidMolecular weight:191.186




