CAS 4884-24-6
:2-Cyclopentylcyclopentanone
Description:
2-Cyclopentylcyclopentanone, with the CAS number 4884-24-6, is a cyclic ketone characterized by its unique bicyclic structure, which consists of two cyclopentane rings connected by a carbonyl group. This compound typically exhibits a colorless to pale yellow liquid form and possesses a distinctive odor. Its molecular formula reflects a moderate level of complexity, contributing to its physical and chemical properties. The presence of the carbonyl group indicates that it can participate in various chemical reactions, such as nucleophilic additions. Additionally, 2-Cyclopentylcyclopentanone is relatively non-polar, which influences its solubility in organic solvents while being less soluble in water. The compound's stability and reactivity can be affected by factors such as temperature and the presence of other functional groups. Due to its structural characteristics, it may find applications in organic synthesis and as an intermediate in the production of other chemical compounds. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2
InChI key:InChIKey=CWZGKTMWPFTJCS-UHFFFAOYSA-N
SMILES:O=C1C(CCC1)C2CCCC2
Synonyms:- 1,1'-Bi(Cyclopentyl)-2-One
- 2-Cyclopentylcyclopentan-1-one
- 2-Cyclopentylcyclopentanone
- Cyclopentanone, 2-cyclopentyl-
- [1,1′-Bicyclopentan]-2-one
- [1,1′-Bicyclopentyl]-2-one
- [Bicyclopentyl]-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
[1,1'-Bi(cyclopentan)]-2-one
CAS:Formula:C10H16OPurity:98%Color and Shape:LiquidMolecular weight:152.23342-Cyclopentylcyclopentanone
CAS:2-CyclopentylcyclopentanoneFormula:C10H16OPurity:98%Molecular weight:152.233442-Cyclopentylcyclopentanone
CAS:Formula:C10H16OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:152.242-Cyclopentylcyclopentanone
CAS:Controlled ProductApplications 2-Cyclopentylcyclopentanone (cas# 4884-24-6) is a useful research chemical.
Formula:C10H16OColor and Shape:NeatMolecular weight:152.232-Cyclopentylcyclopentanone
CAS:2-Cyclopentylcyclopentanone (2-CPC) is a cyclopentenone that is produced by the oxidation of 2-cyclohexenylcyclopentanone. 2-CPC has been shown to be genotoxic and can cause damage to DNA, proteins, or cell membranes. This chemical is used in the manufacture of insecticides and herbicides. It also has used as a solvent for polymers, plastics, and coatings. 2-CPC has been found to be toxic at high doses and should not be handled without proper protection.Formula:C10H16OPurity:Min. 95%Molecular weight:152.24 g/mol





