CymitQuimica logo

CAS 4886-14-0

:

3,5-Bis(methylthio)-4-isothiazolecarboxamide

Description:
3,5-Bis(methylthio)-4-isothiazolecarboxamide, with the CAS number 4886-14-0, is a chemical compound characterized by its isothiazole structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity. The presence of methylthio groups enhances its reactivity and solubility in organic solvents. It is often studied for its applications in agriculture, particularly as a fungicide or herbicide, due to its ability to inhibit specific biological pathways in target organisms. Additionally, the compound may possess antimicrobial properties, making it of interest in pharmaceutical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3,5-Bis(methylthio)-4-isothiazolecarboxamide represents a significant compound in both agricultural and medicinal chemistry contexts.
Formula:C6H8N2OS3
InChI:InChI=1S/C6H8N2OS3/c1-10-5-3(4(7)9)6(11-2)12-8-5/h1-2H3,(H2,7,9)
InChI key:InChIKey=BCSXDEAYNLDINS-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C(SC)=NSC1SC
Synonyms:
  • 3,5-Di(methylthio)isothiazole-4-carboxamide
  • 4-Isothiazolecarboxamide, 3,5-bis(methylthio)-
  • NSC 379558
  • 3,5-Bis(methylthio)-4-isothiazolecarboxamide
  • 3,5-Bis(methylsulfanyl)-1,2-thiazole-4-carboxamide
Found 2 products.