CAS 489-86-1: (-)-Guaiol
Description:(-)-Guaiol is a naturally occurring sesquiterpene alcohol, primarily derived from various plant sources, including guaiacum and certain conifers. It is characterized by its molecular formula, which typically consists of carbon, hydrogen, and oxygen atoms, reflecting its organic nature. The compound is known for its distinctive woody and floral aroma, making it valuable in the fragrance and flavor industries. (-)-Guaiol exhibits a chiral structure, with the "(-)" designation indicating its specific optical activity, meaning it can rotate plane-polarized light in a counterclockwise direction. This compound is also recognized for its potential therapeutic properties, including anti-inflammatory and antimicrobial effects, which have been the subject of various studies. In terms of physical properties, (-)-Guaiol is generally a colorless to pale yellow liquid at room temperature, with a relatively low boiling point. Its solubility varies, being more soluble in organic solvents than in water. Overall, (-)-Guaiol is a compound of interest in both natural product chemistry and applied sciences.
Formula:C15H26O
InChI:InChI=1S/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1
InChI key:InChIKey=TWVJWDMOZJXUID-SDDRHHMPSA-N
SMILES:OC(C)(C)C1CC2=C(CCC2C)C(C)CC1
- Synonyms:
- (3S,5R,8S)-1,2,3,4,5,6,7,8-Octahydro-α,α,3,8-tetramethyl-5-azulenemethanol
- 2-((3S,8S)-1,2,3,4,5,6,7,8-octahydro-3,8-dimethylazulen-5-yl)propan-2-ol
- 2-[(3R,5S,8R)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-ol
- 2-[(3S,5R,8S)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-ol
- 3,8-Dimethyl-5-α-hydroxyisopropyl-Δ<sup>9</sup>-octahydroazulene
- 5-Azulenemethanol, 1,2,3,4,5,6,7,8-octahydro-α,α,3,8-tetramethyl-, (3S,5R,8S)-
- 5-Azulenemethanol, 1,2,3,4,5,6,7,8-octahydro-α,α,3,8-tetramethyl-, [3S-(3α,5α,8α)]-
- 5-Azulenemethanol, 1,2,3,4,5β,6,7,8-octahydro-α,α,3α,8α-tetramethyl-
- Champaca camphor
- Champacol
- See more synonyms
- Guai-1(5)-en-11-ol
- Guaiac alcohol
- NSC 19941
- Guaiol
- ()-Guaiol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Gualol-D7 REF: 3D-AAA48986CAS: 489-86-1 | Min. 95% | - - - | Discontinued product |

Gualol-D7
Ref: 3D-AAA48986
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |