CAS 489402-33-7
:8-(8-chloro-5H-pyrimido[5,4-b]indol-4-yl)-1,4-dioxa-8-azaspiro[4.5]decane
Description:
The chemical substance known as 8-(8-chloro-5H-pyrimido[5,4-b]indol-4-yl)-1,4-dioxa-8-azaspiro[4.5]decane, with the CAS number 489402-33-7, is a complex organic compound characterized by its unique structural features. It contains a spirocyclic framework, which is indicative of its potential biological activity. The presence of a pyrimidine and indole moiety suggests that it may interact with biological targets, possibly influencing various biochemical pathways. The chlorine substituent on the pyrimidine ring can enhance lipophilicity and may affect the compound's pharmacokinetic properties. Additionally, the dioxa and azaspiro components contribute to its overall stability and solubility profile. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of oncology and neurology, due to their ability to modulate specific molecular interactions. However, detailed studies on its biological activity, toxicity, and pharmacological properties would be necessary to fully understand its potential uses in medicinal chemistry.
Formula:C17H17ClN4O2
InChI:InChI=1S/C17H17ClN4O2/c18-11-1-2-13-12(9-11)14-15(21-13)16(20-10-19-14)22-5-3-17(4-6-22)23-7-8-24-17/h1-2,9-10,21H,3-8H2
InChI key:UEXINIASTXLPIV-UHFFFAOYSA-N
SMILES:C1CN(CCC12OCCO2)C3=NC=NC4=C3NC5=C4C=C(C=C5)Cl
Synonyms:- 8-(8-chloro-5H-pyrimido[5,4-b]indol-4-yl)-1,4-dioxa-8-azaspiro[4.5]decane
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
UP158
CAS:UP158 is a VCP small-molecule activator (EC₅₀=2.57 μM) that enhances ATPase activity for protein degradation and neurodegenerative disease studies.Formula:C17H17ClN4O2Color and Shape:SolidMolecular weight:344.795
