CymitQuimica logo

CAS 4896-76-8

:

Glycine-N,N,1-d3

Description:
Glycine-N,N,1-d3, also known as deuterated glycine, is a stable isotope-labeled form of the amino acid glycine, where three hydrogen atoms are replaced by deuterium, a heavier isotope of hydrogen. This compound retains the fundamental characteristics of glycine, which is the simplest amino acid and plays a crucial role in protein synthesis and various metabolic processes. Glycine-N,N,1-d3 is typically utilized in research applications, particularly in NMR spectroscopy and mass spectrometry, to study molecular structures and dynamics due to the distinct spectral properties of deuterium. Its molecular formula remains the same as that of glycine, C2H5NO2, but with the incorporation of deuterium, it exhibits altered physical properties such as increased density and changes in vibrational frequencies. This compound is generally soluble in water and exhibits the characteristic zwitterionic form at physiological pH. As a non-essential amino acid, glycine is involved in the synthesis of proteins, neurotransmitters, and other biomolecules, making its deuterated form valuable for tracing and labeling studies in biochemical research.
Formula:C2H2D3NO2
InChI:InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i/hD3
InChI key:InChIKey=DHMQDGOQFOQNFH-ZRLBSURWSA-N
SMILES:C(CN([2H])[2H])(O[2H])=O
Synonyms:
  • Glycine-N,N,O-d3
  • Glycine-N,N,1-d3
Found 5 products.