CymitQuimica logo

CAS 490039-83-3

:

Benzonitrile, 2-iodo-4-methoxy-

Description:
Benzonitrile, 2-iodo-4-methoxy- is an organic compound characterized by its aromatic structure, featuring a nitrile group (-C≡N) attached to a benzene ring that also contains an iodine atom and a methoxy group (-OCH₃) as substituents. The presence of the iodine atom introduces notable reactivity, particularly in nucleophilic substitution reactions, while the methoxy group can influence the compound's electronic properties and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. Benzonitrile derivatives are often utilized in organic synthesis and may serve as intermediates in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks upon exposure.
Formula:C8H6INO
InChI:InChI=1S/C8H6INO/c1-11-7-3-2-6(5-10)8(9)4-7/h2-4H,1H3
InChI key:AZAICPHBIPICLD-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)C#N)I
Synonyms:
  • 2-Iodo-4-Methoxybenzonitrile
Found 4 products.