CAS 491-52-1

Leucodelphinidin

Description:

Leucodelphinidin is a chemical compound classified as a flavonoid, specifically a type of anthocyanidin. It is a colorless or pale yellow pigment that serves as an intermediate in the biosynthesis of various anthocyanins, which are responsible for the red, purple, and blue colors in many plants. Leucodelphinidin is known for its potential antioxidant properties, contributing to the health benefits associated with the consumption of fruits and vegetables rich in flavonoids. The compound is soluble in water and exhibits stability under acidic conditions, which is relevant for its role in plant coloration and its applications in food science. Additionally, leucodelphinidin can undergo further transformations to form colored anthocyanins when subjected to specific pH conditions. Its presence is often studied in the context of plant biochemistry and nutrition, as well as in the development of natural colorants for food and beverages. Overall, leucodelphinidin plays a significant role in both plant physiology and potential health-related applications.

Formula: C₁₅H₁₄O₈

InChI: InChI=1S/C15H14O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,13-22H/t13-,14-,15+/m0/s1

InChI key: InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N

SMILES: O[C@H]1C=2C(O[C@@H]([C@H]1O)C3=CC(O)=C(O)C(O)=C3)=CC(O)=CC2O

Synonyms:

• Leucodelphidin
• 2H-1-Benzopyran-3,4,5,7-tetrol, 3,4-dihydro-2-(3,4,5-trihydroxyphenyl)-, (2R,3S,4S)-
• Leucodelphinidin
• 3,3′,4,4′,5,5′,7-Flavanheptol
• (2R,3S,4S)-3,4-Dihydro-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3,4,5,7-tetrol

Leukoefdin

CAS: 491-52-1

Leukoefdin is a colorless chemical compound related to leucoanthocyanidins.

Formula: C₁₅H₁₄O₈

Color and Shape: Solid

Molecular weight: 322.269

Ref: TM-T32679